C20H24NO3+ — CID 9264240
2-(furan-2-yl)ethyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium (PubChem CID 9264240) has the molecular formula C20H24NO3+ and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(furan-2-yl)ethyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium.
| Compound Name | 2-(furan-2-yl)ethyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9264240 |
| Molecular Formula | C20H24NO3+ |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-(furan-2-yl)ethyl-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH2+]CCc3ccco3)c2cc1C(C)C |
| InChI | InChI=1S/C20H23NO3/c1-13(2)17-11-18-15(10-20(22)24-19(18)9-14(17)3)12-21-7-6-16-5-4-8-23-16/h4-5,8-11,13,21H,6-7,12H2,1-3H3/p+1 |
| InChIKey | UFAPOPXAZSGFMH-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 59.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|