C18H19NO3 — CID 8920388
4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 8920388) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 8920388 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-[[[(1S)-1-(furan-2-yl)ethyl]amino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN[C@@H](C)c3ccco3)c2cc1C |
| InChI | InChI=1S/C18H19NO3/c1-11-7-15-14(9-18(20)22-17(15)8-12(11)2)10-19-13(3)16-5-4-6-21-16/h4-9,13,19H,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | IMMXCWWJDWXGCT-ZDUSSCGKSA-N |
| XLogP | 3.85 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|