C20H21NO2 — CID 9256676
6,7-dimethyl-4-[[(4-methylphenyl)methylamino]methyl]chromen-2-one (PubChem CID 9256676) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[(4-methylphenyl)methylamino]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[(4-methylphenyl)methylamino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9256676 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6,7-dimethyl-4-[[(4-methylphenyl)methylamino]methyl]chromen-2-one |
| SMILES | Cc1ccc(CNCc2cc(=O)oc3cc(C)c(C)cc23)cc1 |
| InChI | InChI=1S/C20H21NO2/c1-13-4-6-16(7-5-13)11-21-12-17-10-20(22)23-19-9-15(3)14(2)8-18(17)19/h4-10,21H,11-12H2,1-3H3 |
| InChIKey | VYTPTPFDDYVFGD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|