C22H25NO4 — CID 9436672
4-[[2-(4-ethoxyphenoxy)ethylamino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 9436672) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[2-(4-ethoxyphenoxy)ethylamino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[2-(4-ethoxyphenoxy)ethylamino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9436672 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[[2-(4-ethoxyphenoxy)ethylamino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | CCOc1ccc(OCCNCc2cc(=O)oc3cc(C)c(C)cc23)cc1 |
| InChI | InChI=1S/C22H25NO4/c1-4-25-18-5-7-19(8-6-18)26-10-9-23-14-17-13-22(24)27-21-12-16(3)15(2)11-20(17)21/h5-8,11-13,23H,4,9-10,14H2,1-3H3 |
| InChIKey | QGWPQGJHHRKTFC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|