C25H30N2O3 — CID 9256891
4-[[[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 9256891) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[[[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 9256891 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 4-[[[(2S)-2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | COc1ccc([C@@H](CNCc2cc(=O)oc3cc(C)c(C)cc23)N2CCCC2)cc1 |
| InChI | InChI=1S/C25H30N2O3/c1-17-12-22-20(14-25(28)30-24(22)13-18(17)2)15-26-16-23(27-10-4-5-11-27)19-6-8-21(29-3)9-7-19/h6-9,12-14,23,26H,4-5,10-11,15-16H2,1-3H3/t23-/m1/s1 |
| InChIKey | IEOJVRGTAGMHAR-HSZRJFAPSA-N |
| XLogP | 4.35 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|