C22H26N2O3S — CID 9265997
6,7-dimethyl-4-[[[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one (PubChem CID 9265997) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9265997 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 6,7-dimethyl-4-[[[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNC[C@@H](c3cccs3)N3CCOCC3)c2cc1C |
| InChI | InChI=1S/C22H26N2O3S/c1-15-10-18-17(12-22(25)27-20(18)11-16(15)2)13-23-14-19(21-4-3-9-28-21)24-5-7-26-8-6-24/h3-4,9-12,19,23H,5-8,13-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | DXSGWPGKSJFIGY-IBGZPJMESA-N |
| XLogP | 3.63 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|