C24H24N2O3S — CID 84967087
1-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]benzo[f]chromen-3-one (PubChem CID 84967087) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]benzo[f]chromen-3-one.
| Compound Name | 1-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 84967087 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methyl]benzo[f]chromen-3-one |
| SMILES | O=c1cc(CNCC(c2cccs2)N2CCOCC2)c2c(ccc3ccccc32)o1 |
| InChI | InChI=1S/C24H24N2O3S/c27-23-14-18(24-19-5-2-1-4-17(19)7-8-21(24)29-23)15-25-16-20(22-6-3-13-30-22)26-9-11-28-12-10-26/h1-8,13-14,20,25H,9-12,15-16H2 |
| InChIKey | XLWBMZZGFZRVGT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|