C24H30N2O2S — CID 9263164
7-methyl-6-propan-2-yl-4-[[[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one (PubChem CID 9263164) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is 7-methyl-6-propan-2-yl-4-[[[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one.
| Compound Name | 7-methyl-6-propan-2-yl-4-[[[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one |
|---|---|
| PubChem CID | 9263164 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 7-methyl-6-propan-2-yl-4-[[[(2R)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]amino]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNC[C@H](c3cccs3)N3CCCC3)c2cc1C(C)C |
| InChI | InChI=1S/C24H30N2O2S/c1-16(2)19-13-20-18(12-24(27)28-22(20)11-17(19)3)14-25-15-21(23-7-6-10-29-23)26-8-4-5-9-26/h6-7,10-13,16,21,25H,4-5,8-9,14-15H2,1-3H3/t21-/m1/s1 |
| InChIKey | QZCSWQKFYZZUCT-OAQYLSRUSA-N |
| XLogP | 5.21 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|