C20H18N2O4S — CID 27144375
3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one (PubChem CID 27144375) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one.
| Compound Name | 3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 27144375 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-thiophen-2-yl-1,3,4-oxadiazol-2-one |
| SMILES | Cc1cc2oc(=O)cc(Cn3nc(-c4cccs4)oc3=O)c2cc1C(C)C |
| InChI | InChI=1S/C20H18N2O4S/c1-11(2)14-9-15-13(8-18(23)25-16(15)7-12(14)3)10-22-20(24)26-19(21-22)17-5-4-6-27-17/h4-9,11H,10H2,1-3H3 |
| InChIKey | QVRBWCRSLWNEAK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|