C30H28N2O4 — CID 4301529
5-benzyl-3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-phenylimidazolidine-2,4-dione (PubChem CID 4301529) has the molecular formula C30H28N2O4 and a molecular weight of 480.56 g/mol. Its IUPAC name is 5-benzyl-3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4301529 |
| Molecular Formula | C30H28N2O4 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 5-benzyl-3-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]-5-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cc2oc(=O)cc(CN3C(=O)NC(Cc4ccccc4)(c4ccccc4)C3=O)c2cc1C(C)C |
| InChI | InChI=1S/C30H28N2O4/c1-19(2)24-16-25-22(15-27(33)36-26(25)14-20(24)3)18-32-28(34)30(31-29(32)35,23-12-8-5-9-13-23)17-21-10-6-4-7-11-21/h4-16,19H,17-18H2,1-3H3,(H,31,35) |
| InChIKey | WWRPSUXFVLBHDZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|