C28H29NO2 — CID 2465808
4-[(dibenzylamino)methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 2465808) has the molecular formula C28H29NO2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[(dibenzylamino)methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[(dibenzylamino)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 2465808 |
| Molecular Formula | C28H29NO2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 4-[(dibenzylamino)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(Cc3ccccc3)Cc3ccccc3)c2cc1C(C)C |
| InChI | InChI=1S/C28H29NO2/c1-20(2)25-16-26-24(15-28(30)31-27(26)14-21(25)3)19-29(17-22-10-6-4-7-11-22)18-23-12-8-5-9-13-23/h4-16,20H,17-19H2,1-3H3 |
| InChIKey | OZKQTSVUAVJNML-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|