C21H25N2O2+ — CID 8864736
4-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 8864736) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 8864736 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 4-[[4-(dimethylamino)pyridin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(C[n+]3ccc(N(C)C)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C21H25N2O2/c1-14(2)18-12-19-16(11-21(24)25-20(19)10-15(18)3)13-23-8-6-17(7-9-23)22(4)5/h6-12,14H,13H2,1-5H3/q+1 |
| InChIKey | VGDKDRMKTYPQCN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|