C17H22O4S — CID 99814044
4-[[(2S)-2,3-dihydroxypropyl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 99814044) has the molecular formula C17H22O4S and a molecular weight of 322.43 g/mol. Its IUPAC name is 4-[[(2S)-2,3-dihydroxypropyl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[(2S)-2,3-dihydroxypropyl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 99814044 |
| Molecular Formula | C17H22O4S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-[[(2S)-2,3-dihydroxypropyl]sulfanylmethyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CSC[C@@H](O)CO)c2cc1C(C)C |
| InChI | InChI=1S/C17H22O4S/c1-10(2)14-6-15-12(8-22-9-13(19)7-18)5-17(20)21-16(15)4-11(14)3/h4-6,10,13,18-19H,7-9H2,1-3H3/t13-/m0/s1 |
| InChIKey | AMZYOPMTDNCTTP-ZDUSSCGKSA-N |
| XLogP | 2.81 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|