C16H20N2O2S — CID 8776334
(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl N'-methylcarbamimidothioate (PubChem CID 8776334) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl N'-methylcarbamimidothioate.
| Compound Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 8776334 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)SCc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C16H20N2O2S/c1-9(2)12-7-13-11(8-21-16(17)18-4)6-15(19)20-14(13)5-10(12)3/h5-7,9H,8H2,1-4H3,(H2,17,18) |
| InChIKey | TWJKBPAYLUUVDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|