C21H20N2O3S2 — CID 35861513
3-methyl-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-one (PubChem CID 35861513) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-methyl-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 35861513 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 3-methyl-2-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc4sccc4c(=O)n3C)c2cc1C(C)C |
| InChI | InChI=1S/C21H20N2O3S2/c1-11(2)15-9-16-13(8-18(24)26-17(16)7-12(15)3)10-28-21-22-19-14(5-6-27-19)20(25)23(21)4/h5-9,11H,10H2,1-4H3 |
| InChIKey | OEOPNOGKUUOOGH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|