C20H15ClN2O3S — CID 35861110
2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-methylquinazolin-4-one (PubChem CID 35861110) has the molecular formula C20H15ClN2O3S and a molecular weight of 398.87 g/mol. Its IUPAC name is 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-methylquinazolin-4-one.
| Compound Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 35861110 |
| Molecular Formula | C20H15ClN2O3S |
| Molecular Weight | 398.87 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-methylquinazolin-4-one |
| SMILES | Cc1cc2oc(=O)cc(CSc3nc4ccccc4c(=O)n3C)c2cc1Cl |
| InChI | InChI=1S/C20H15ClN2O3S/c1-11-7-17-14(9-15(11)21)12(8-18(24)26-17)10-27-20-22-16-6-4-3-5-13(16)19(25)23(20)2/h3-9H,10H2,1-2H3 |
| InChIKey | UPLSFFOKOYRZST-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.87 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|