C23H20Cl2N2O4S — CID 42015461
7-chloro-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 42015461) has the molecular formula C23H20Cl2N2O4S and a molecular weight of 491.40 g/mol. Its IUPAC name is 7-chloro-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42015461 |
| Molecular Formula | C23H20Cl2N2O4S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.05 |
| IUPAC Name | 7-chloro-2-[(6-chloro-7-methyl-2-oxochromen-4-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | COCCCn1c(SCc2cc(=O)oc3cc(C)c(Cl)cc23)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H20Cl2N2O4S/c1-13-8-20-17(11-18(13)25)14(9-21(28)31-20)12-32-23-26-19-10-15(24)4-5-16(19)22(29)27(23)6-3-7-30-2/h4-5,8-11H,3,6-7,12H2,1-2H3 |
| InChIKey | OSLYNVFOCDLYOQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|