C17H19ClN4O3S — CID 37135543
7-chloro-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one (PubChem CID 37135543) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is 7-chloro-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
|---|---|
| PubChem CID | 37135543 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 7-chloro-2-[(5-ethyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3-(3-methoxypropyl)quinazolin-4-one |
| SMILES | CCc1nnc(CSc2nc3cc(Cl)ccc3c(=O)n2CCCOC)o1 |
| InChI | InChI=1S/C17H19ClN4O3S/c1-3-14-20-21-15(25-14)10-26-17-19-13-9-11(18)5-6-12(13)16(23)22(17)7-4-8-24-2/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | MSCUVNNTBNKYLN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|