C26H21ClN2O4S — CID 42015452
7-chloro-3-(3-methoxypropyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 42015452) has the molecular formula C26H21ClN2O4S and a molecular weight of 492.98 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxypropyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxypropyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42015452 |
| Molecular Formula | C26H21ClN2O4S |
| Molecular Weight | 492.98 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 7-chloro-3-(3-methoxypropyl)-2-[(3-oxobenzo[f]chromen-1-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCc2cc(=O)oc3ccc4ccccc4c23)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C26H21ClN2O4S/c1-32-12-4-11-29-25(31)20-9-8-18(27)14-21(20)28-26(29)34-15-17-13-23(30)33-22-10-7-16-5-2-3-6-19(16)24(17)22/h2-3,5-10,13-14H,4,11-12,15H2,1H3 |
| InChIKey | GMJRTROGXGKHOV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.98 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|