C20H18ClN3O2S3 — CID 46805368
7-chloro-3-(3-methoxypropyl)-2-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylsulfanyl]quinazolin-4-one (PubChem CID 46805368) has the molecular formula C20H18ClN3O2S3 and a molecular weight of 464.04 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxypropyl)-2-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxypropyl)-2-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 46805368 |
| Molecular Formula | C20H18ClN3O2S3 |
| Molecular Weight | 464.04 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 7-chloro-3-(3-methoxypropyl)-2-[(2-thiophen-2-yl-1,3-thiazol-4-yl)methylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCc2csc(-c3cccs3)n2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H18ClN3O2S3/c1-26-8-3-7-24-19(25)15-6-5-13(21)10-16(15)23-20(24)29-12-14-11-28-18(22-14)17-4-2-9-27-17/h2,4-6,9-11H,3,7-8,12H2,1H3 |
| InChIKey | PYUSFGWNUPFSTO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.04 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|