C20H19ClN4O3S2 — CID 55401057
7-chloro-3-(2-methoxyethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one (PubChem CID 55401057) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 7-chloro-3-(2-methoxyethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(2-methoxyethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55401057 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 7-chloro-3-(2-methoxyethyl)-2-[3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
| SMILES | COCCn1c(SCCCc2nc(-c3cccs3)no2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H19ClN4O3S2/c1-27-9-8-25-19(26)14-7-6-13(21)12-15(14)22-20(25)30-11-3-5-17-23-18(24-28-17)16-4-2-10-29-16/h2,4,6-7,10,12H,3,5,8-9,11H2,1H3 |
| InChIKey | WMIOTLHZCFEXDE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|