C21H20ClFN2O3S — CID 2611223
7-chloro-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 2611223) has the molecular formula C21H20ClFN2O3S and a molecular weight of 434.92 g/mol. Its IUPAC name is 7-chloro-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 2611223 |
| Molecular Formula | C21H20ClFN2O3S |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 7-chloro-2-[4-(4-fluorophenyl)-4-oxobutyl]sulfanyl-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1c(SCCCC(=O)c2ccc(F)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H20ClFN2O3S/c1-28-11-10-25-20(27)17-9-6-15(22)13-18(17)24-21(25)29-12-2-3-19(26)14-4-7-16(23)8-5-14/h4-9,13H,2-3,10-12H2,1H3 |
| InChIKey | WNWZXKFPDVRYRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|