C19H16ClFN4O5S — CID 2611294
2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide (PubChem CID 2611294) has the molecular formula C19H16ClFN4O5S and a molecular weight of 466.88 g/mol. Its IUPAC name is 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide.
| Compound Name | 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2611294 |
| Molecular Formula | C19H16ClFN4O5S |
| Molecular Weight | 466.88 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanyl-N-(4-fluoro-3-nitrophenyl)acetamide |
| SMILES | COCCn1c(SCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H16ClFN4O5S/c1-30-7-6-24-18(27)13-4-2-11(20)8-15(13)23-19(24)31-10-17(26)22-12-3-5-14(21)16(9-12)25(28)29/h2-5,8-9H,6-7,10H2,1H3,(H,22,26) |
| InChIKey | KZKLOSCVTAWWRP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|