C18H23ClN4O4S — CID 27361380
N-(butylcarbamoyl)-2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 27361380) has the molecular formula C18H23ClN4O4S and a molecular weight of 426.93 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(butylcarbamoyl)-2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27361380 |
| Molecular Formula | C18H23ClN4O4S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-(butylcarbamoyl)-2-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1CCOC |
| InChI | InChI=1S/C18H23ClN4O4S/c1-3-4-7-20-17(26)22-15(24)11-28-18-21-14-10-12(19)5-6-13(14)16(25)23(18)8-9-27-2/h5-6,10H,3-4,7-9,11H2,1-2H3,(H2,20,22,24,26) |
| InChIKey | USICDGXNHQVZIG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|