C23H25ClN4O4S — CID 27270394
2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,3-dimethylphenyl)carbamoyl]acetamide (PubChem CID 27270394) has the molecular formula C23H25ClN4O4S and a molecular weight of 489.00 g/mol. Its IUPAC name is 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,3-dimethylphenyl)carbamoyl]acetamide.
| Compound Name | 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,3-dimethylphenyl)carbamoyl]acetamide |
|---|---|
| PubChem CID | 27270394 |
| Molecular Formula | C23H25ClN4O4S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[7-chloro-3-(3-methoxypropyl)-4-oxoquinazolin-2-yl]sulfanyl-N-[(2,3-dimethylphenyl)carbamoyl]acetamide |
| SMILES | COCCCn1c(SCC(=O)NC(=O)Nc2cccc(C)c2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C23H25ClN4O4S/c1-14-6-4-7-18(15(14)2)25-22(31)27-20(29)13-33-23-26-19-12-16(24)8-9-17(19)21(30)28(23)10-5-11-32-3/h4,6-9,12H,5,10-11,13H2,1-3H3,(H2,25,27,29,31) |
| InChIKey | AYLHQYKUNUXYAI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|