C21H23ClN2O3S — CID 42402642
7-chloro-3-(3-methoxypropyl)-2-[2-(2-methylphenoxy)ethylsulfanyl]quinazolin-4-one (PubChem CID 42402642) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxypropyl)-2-[2-(2-methylphenoxy)ethylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxypropyl)-2-[2-(2-methylphenoxy)ethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42402642 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 7-chloro-3-(3-methoxypropyl)-2-[2-(2-methylphenoxy)ethylsulfanyl]quinazolin-4-one |
| SMILES | COCCCn1c(SCCOc2ccccc2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H23ClN2O3S/c1-15-6-3-4-7-19(15)27-12-13-28-21-23-18-14-16(22)8-9-17(18)20(25)24(21)10-5-11-26-2/h3-4,6-9,14H,5,10-13H2,1-2H3 |
| InChIKey | RTTFBNSGJXNMJT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|