C21H21ClN4O3S — CID 16504946
7-chloro-3-(2-methoxyethyl)-2-[3-(2-oxo-3H-benzimidazol-1-yl)propylsulfanyl]quinazolin-4-one (PubChem CID 16504946) has the molecular formula C21H21ClN4O3S and a molecular weight of 444.94 g/mol. Its IUPAC name is 7-chloro-3-(2-methoxyethyl)-2-[3-(2-oxo-3H-benzimidazol-1-yl)propylsulfanyl]quinazolin-4-one.
| Compound Name | 7-chloro-3-(2-methoxyethyl)-2-[3-(2-oxo-3H-benzimidazol-1-yl)propylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 16504946 |
| Molecular Formula | C21H21ClN4O3S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 7-chloro-3-(2-methoxyethyl)-2-[3-(2-oxo-3H-benzimidazol-1-yl)propylsulfanyl]quinazolin-4-one |
| SMILES | COCCn1c(SCCCn2c(=O)[nH]c3ccccc32)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H21ClN4O3S/c1-29-11-10-26-19(27)15-8-7-14(22)13-17(15)24-21(26)30-12-4-9-25-18-6-3-2-5-16(18)23-20(25)28/h2-3,5-8,13H,4,9-12H2,1H3,(H,23,28) |
| InChIKey | IOQLOXPWFBIJOA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|