C20H20ClFN2O3S — CID 112775431
7-chloro-2-[3-(4-fluorophenoxy)propylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 112775431) has the molecular formula C20H20ClFN2O3S and a molecular weight of 422.91 g/mol. Its IUPAC name is 7-chloro-2-[3-(4-fluorophenoxy)propylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 7-chloro-2-[3-(4-fluorophenoxy)propylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 112775431 |
| Molecular Formula | C20H20ClFN2O3S |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 7-chloro-2-[3-(4-fluorophenoxy)propylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1c(SCCCOc2ccc(F)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H20ClFN2O3S/c1-26-11-9-24-19(25)17-8-3-14(21)13-18(17)23-20(24)28-12-2-10-27-16-6-4-15(22)5-7-16/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | IQSZTZAGHXLDQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|