C16H18ClN3O2S — CID 112775432
5-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile (PubChem CID 112775432) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 5-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile.
| Compound Name | 5-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
|---|---|
| PubChem CID | 112775432 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 5-[7-chloro-3-(2-methoxyethyl)-4-oxoquinazolin-2-yl]sulfanylpentanenitrile |
| SMILES | COCCn1c(SCCCCC#N)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C16H18ClN3O2S/c1-22-9-8-20-15(21)13-6-5-12(17)11-14(13)19-16(20)23-10-4-2-3-7-18/h5-6,11H,2-4,8-10H2,1H3 |
| InChIKey | LDFVELIXAAGLNB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|