C18H22ClN3OS — CID 112777897
5-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanylpentanenitrile (PubChem CID 112777897) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is 5-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanylpentanenitrile.
| Compound Name | 5-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanylpentanenitrile |
|---|---|
| PubChem CID | 112777897 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-(7-chloro-4-oxo-3-pentylquinazolin-2-yl)sulfanylpentanenitrile |
| SMILES | CCCCCn1c(SCCCCC#N)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C18H22ClN3OS/c1-2-3-6-11-22-17(23)15-9-8-14(19)13-16(15)21-18(22)24-12-7-4-5-10-20/h8-9,13H,2-7,11-12H2,1H3 |
| InChIKey | APBADTSEKOVVOO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|