C23H23N3O3S — CID 112778275
methyl 2-(4-cyanobutylsulfanyl)-4-oxo-3-(2-phenylethyl)quinazoline-7-carboxylate (PubChem CID 112778275) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is methyl 2-(4-cyanobutylsulfanyl)-4-oxo-3-(2-phenylethyl)quinazoline-7-carboxylate.
| Compound Name | methyl 2-(4-cyanobutylsulfanyl)-4-oxo-3-(2-phenylethyl)quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 112778275 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl 2-(4-cyanobutylsulfanyl)-4-oxo-3-(2-phenylethyl)quinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(CCc3ccccc3)c(SCCCCC#N)nc2c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-29-22(28)18-10-11-19-20(16-18)25-23(30-15-7-3-6-13-24)26(21(19)27)14-12-17-8-4-2-5-9-17/h2,4-5,8-11,16H,3,6-7,12,14-15H2,1H3 |
| InChIKey | ARUPZDJXCKLPJX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|