C21H30N2O5S — CID 55883318
methyl 3-(3-methoxypropyl)-2-[2-(3-methylbutoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate (PubChem CID 55883318) has the molecular formula C21H30N2O5S and a molecular weight of 422.55 g/mol. Its IUPAC name is methyl 3-(3-methoxypropyl)-2-[2-(3-methylbutoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-(3-methoxypropyl)-2-[2-(3-methylbutoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 55883318 |
| Molecular Formula | C21H30N2O5S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | methyl 3-(3-methoxypropyl)-2-[2-(3-methylbutoxy)ethylsulfanyl]-4-oxoquinazoline-7-carboxylate |
| SMILES | COCCCn1c(SCCOCCC(C)C)nc2cc(C(=O)OC)ccc2c1=O |
| InChI | InChI=1S/C21H30N2O5S/c1-15(2)8-11-28-12-13-29-21-22-18-14-16(20(25)27-4)6-7-17(18)19(24)23(21)9-5-10-26-3/h6-7,14-15H,5,8-13H2,1-4H3 |
| InChIKey | WUQUNYAJJLPSJW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|