C16H17N3O4S — CID 7849143
methyl 2-(2-cyanoethylsulfanyl)-3-[(2R)-2-hydroxypropyl]-4-oxoquinazoline-7-carboxylate (PubChem CID 7849143) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is methyl 2-(2-cyanoethylsulfanyl)-3-[(2R)-2-hydroxypropyl]-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 2-(2-cyanoethylsulfanyl)-3-[(2R)-2-hydroxypropyl]-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7849143 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | methyl 2-(2-cyanoethylsulfanyl)-3-[(2R)-2-hydroxypropyl]-4-oxoquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(C[C@@H](C)O)c(SCCC#N)nc2c1 |
| InChI | InChI=1S/C16H17N3O4S/c1-10(20)9-19-14(21)12-5-4-11(15(22)23-2)8-13(12)18-16(19)24-7-3-6-17/h4-5,8,10,20H,3,7,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | CEHIPAUUKSORMQ-SNVBAGLBSA-N |
| XLogP | 1.57 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|