C20H17N3O3S — CID 7953789
methyl 2-(3-cyanopropylsulfanyl)-4-oxo-3-phenylquinazoline-7-carboxylate (PubChem CID 7953789) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is methyl 2-(3-cyanopropylsulfanyl)-4-oxo-3-phenylquinazoline-7-carboxylate.
| Compound Name | methyl 2-(3-cyanopropylsulfanyl)-4-oxo-3-phenylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 7953789 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | methyl 2-(3-cyanopropylsulfanyl)-4-oxo-3-phenylquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccccc3)c(SCCCC#N)nc2c1 |
| InChI | InChI=1S/C20H17N3O3S/c1-26-19(25)14-9-10-16-17(13-14)22-20(27-12-6-5-11-21)23(18(16)24)15-7-3-2-4-8-15/h2-4,7-10,13H,5-6,12H2,1H3 |
| InChIKey | ZYAVHFYMNBXJOF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 84.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|