C33H28N4O5S — CID 3493384
methyl 2-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]sulfanyl-4-oxo-3-phenylquinazoline-7-carboxylate (PubChem CID 3493384) has the molecular formula C33H28N4O5S and a molecular weight of 592.68 g/mol. Its IUPAC name is methyl 2-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]sulfanyl-4-oxo-3-phenylquinazoline-7-carboxylate.
| Compound Name | methyl 2-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]sulfanyl-4-oxo-3-phenylquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 3493384 |
| Molecular Formula | C33H28N4O5S |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | methyl 2-[1,3-bis(benzylamino)-1,3-dioxopropan-2-yl]sulfanyl-4-oxo-3-phenylquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(-c3ccccc3)c(SC(C(=O)NCc3ccccc3)C(=O)NCc3ccccc3)nc2c1 |
| InChI | InChI=1S/C33H28N4O5S/c1-42-32(41)24-17-18-26-27(19-24)36-33(37(31(26)40)25-15-9-4-10-16-25)43-28(29(38)34-20-22-11-5-2-6-12-22)30(39)35-21-23-13-7-3-8-14-23/h2-19,28H,20-21H2,1H3,(H,34,38)(H,35,39) |
| InChIKey | VJJUYXPKSXDSNL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|