C37H36FN5O4S — CID 46369732
N,N'-dibenzyl-2-[7-[(4-fluorophenyl)carbamoyl]-4-oxo-3-pentylquinazolin-2-yl]sulfanylpropanediamide (PubChem CID 46369732) has the molecular formula C37H36FN5O4S and a molecular weight of 665.79 g/mol. Its IUPAC name is N,N'-dibenzyl-2-[7-[(4-fluorophenyl)carbamoyl]-4-oxo-3-pentylquinazolin-2-yl]sulfanylpropanediamide.
| Compound Name | N,N'-dibenzyl-2-[7-[(4-fluorophenyl)carbamoyl]-4-oxo-3-pentylquinazolin-2-yl]sulfanylpropanediamide |
|---|---|
| PubChem CID | 46369732 |
| Molecular Formula | C37H36FN5O4S |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | N,N'-dibenzyl-2-[7-[(4-fluorophenyl)carbamoyl]-4-oxo-3-pentylquinazolin-2-yl]sulfanylpropanediamide |
| SMILES | CCCCCn1c(SC(C(=O)NCc2ccccc2)C(=O)NCc2ccccc2)nc2cc(C(=O)Nc3ccc(F)cc3)ccc2c1=O |
| InChI | InChI=1S/C37H36FN5O4S/c1-2-3-10-21-43-36(47)30-20-15-27(33(44)41-29-18-16-28(38)17-19-29)22-31(30)42-37(43)48-32(34(45)39-23-25-11-6-4-7-12-25)35(46)40-24-26-13-8-5-9-14-26/h4-9,11-20,22,32H,2-3,10,21,23-24H2,1H3,(H,39,45)(H,40,46)(H,41,44) |
| InChIKey | GJFISHITONWFDA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|