C24H23N3O2S — CID 8674923
(2R)-N-benzyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide (PubChem CID 8674923) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (2R)-N-benzyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-benzyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8674923 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (2R)-N-benzyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)NCc2ccccc2)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C24H23N3O2S/c1-3-27-23(29)20-13-18-11-7-8-12-19(18)14-21(20)26-24(27)30-16(2)22(28)25-15-17-9-5-4-6-10-17/h4-14,16H,3,15H2,1-2H3,(H,25,28)/t16-/m1/s1 |
| InChIKey | HIGHQFCCPNALEH-MRXNPFEDSA-N |
| XLogP | 4.37 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|