C23H26N4O2S — CID 8674984
(2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide (PubChem CID 8674984) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 8674984 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (2R)-N-[(2R)-2-cyano-3-methylbutan-2-yl]-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylpropanamide |
| SMILES | CCn1c(S[C@H](C)C(=O)N[C@@](C)(C#N)C(C)C)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C23H26N4O2S/c1-6-27-21(29)18-11-16-9-7-8-10-17(16)12-19(18)25-22(27)30-15(4)20(28)26-23(5,13-24)14(2)3/h7-12,14-15H,6H2,1-5H3,(H,26,28)/t15-,23+/m1/s1 |
| InChIKey | TVOMSFPBQIOVTP-CMJOXMDJSA-N |
| XLogP | 4.10 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|