C21H22N4O2S — CID 8973427
(2S)-N-(2-cyanoethyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methylpropanamide (PubChem CID 8973427) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is (2S)-N-(2-cyanoethyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methylpropanamide.
| Compound Name | (2S)-N-(2-cyanoethyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 8973427 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2S)-N-(2-cyanoethyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanyl-N-methylpropanamide |
| SMILES | CCn1c(S[C@@H](C)C(=O)N(C)CCC#N)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C21H22N4O2S/c1-4-25-20(27)17-12-15-8-5-6-9-16(15)13-18(17)23-21(25)28-14(2)19(26)24(3)11-7-10-22/h5-6,8-9,12-14H,4,7,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | GPLSKXWRSCJMOT-AWEZNQCLSA-N |
| XLogP | 3.42 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|