C17H22IN3O2S — CID 4314425
N,N-diethyl-2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylpropanamide (PubChem CID 4314425) has the molecular formula C17H22IN3O2S and a molecular weight of 459.35 g/mol. Its IUPAC name is N,N-diethyl-2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | N,N-diethyl-2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 4314425 |
| Molecular Formula | C17H22IN3O2S |
| Molecular Weight | 459.35 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | N,N-diethyl-2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)Sc1nc2ccc(I)cc2c(=O)n1CC |
| InChI | InChI=1S/C17H22IN3O2S/c1-5-20(6-2)15(22)11(4)24-17-19-14-9-8-12(18)10-13(14)16(23)21(17)7-3/h8-11H,5-7H2,1-4H3 |
| InChIKey | ZMFSIZMTEIWPKW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|