C12H12IN3O2S — CID 1214252
2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 1214252) has the molecular formula C12H12IN3O2S and a molecular weight of 389.22 g/mol. Its IUPAC name is 2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | 2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1214252 |
| Molecular Formula | C12H12IN3O2S |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 2-(3-ethyl-6-iodo-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(N)=O)nc2ccc(I)cc2c1=O |
| InChI | InChI=1S/C12H12IN3O2S/c1-2-16-11(18)8-5-7(13)3-4-9(8)15-12(16)19-6-10(14)17/h3-5H,2,6H2,1H3,(H2,14,17) |
| InChIKey | KSNIRGOFNWEXBP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|