C19H17IN2O3S — CID 1288069
ethyl 2-[6-iodo-3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 1288069) has the molecular formula C19H17IN2O3S and a molecular weight of 480.33 g/mol. Its IUPAC name is ethyl 2-[6-iodo-3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[6-iodo-3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 1288069 |
| Molecular Formula | C19H17IN2O3S |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | ethyl 2-[6-iodo-3-(3-methylphenyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1nc2ccc(I)cc2c(=O)n1-c1cccc(C)c1 |
| InChI | InChI=1S/C19H17IN2O3S/c1-3-25-17(23)11-26-19-21-16-8-7-13(20)10-15(16)18(24)22(19)14-6-4-5-12(2)9-14/h4-10H,3,11H2,1-2H3 |
| InChIKey | GVOWMQIGXKKLAA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|