C20H18IN3O3S — CID 1257455
6-iodo-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-3-phenylquinazolin-4-one (PubChem CID 1257455) has the molecular formula C20H18IN3O3S and a molecular weight of 507.35 g/mol. Its IUPAC name is 6-iodo-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-3-phenylquinazolin-4-one.
| Compound Name | 6-iodo-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 1257455 |
| Molecular Formula | C20H18IN3O3S |
| Molecular Weight | 507.35 g/mol |
| Exact Mass | 507.01 |
| IUPAC Name | 6-iodo-2-(2-morpholin-4-yl-2-oxoethyl)sulfanyl-3-phenylquinazolin-4-one |
| SMILES | O=C(CSc1nc2ccc(I)cc2c(=O)n1-c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H18IN3O3S/c21-14-6-7-17-16(12-14)19(26)24(15-4-2-1-3-5-15)20(22-17)28-13-18(25)23-8-10-27-11-9-23/h1-7,12H,8-11,13H2 |
| InChIKey | QIKPMQOROZPULY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|