C16H20BrN3O2S — CID 18078900
2-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-butylacetamide (PubChem CID 18078900) has the molecular formula C16H20BrN3O2S and a molecular weight of 398.33 g/mol. Its IUPAC name is 2-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-butylacetamide.
| Compound Name | 2-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-butylacetamide |
|---|---|
| PubChem CID | 18078900 |
| Molecular Formula | C16H20BrN3O2S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-(6-bromo-3-ethyl-4-oxoquinazolin-2-yl)sulfanyl-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nc2ccc(Br)cc2c(=O)n1CC |
| InChI | InChI=1S/C16H20BrN3O2S/c1-3-5-8-18-14(21)10-23-16-19-13-7-6-11(17)9-12(13)15(22)20(16)4-2/h6-7,9H,3-5,8,10H2,1-2H3,(H,18,21) |
| InChIKey | WVHLRVVMHZLJDB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|