C21H24N4O3S — CID 8973360
N-(butylcarbamoyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide (PubChem CID 8973360) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(butylcarbamoyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8973360 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | N-(butylcarbamoyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1nc2cc3ccccc3cc2c(=O)n1CC |
| InChI | InChI=1S/C21H24N4O3S/c1-3-5-10-22-20(28)24-18(26)13-29-21-23-17-12-15-9-7-6-8-14(15)11-16(17)19(27)25(21)4-2/h6-9,11-12H,3-5,10,13H2,1-2H3,(H2,22,24,26,28) |
| InChIKey | GQAZWIUSRQTBHL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|