C24H23N3O2S — CID 8674854
N-(2,4-dimethylphenyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide (PubChem CID 8674854) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8674854 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccc(C)cc2C)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C24H23N3O2S/c1-4-27-23(29)19-12-17-7-5-6-8-18(17)13-21(19)26-24(27)30-14-22(28)25-20-10-9-15(2)11-16(20)3/h5-13H,4,14H2,1-3H3,(H,25,28) |
| InChIKey | WUFWWHRDKRWKDT-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|