C18H18N4O3S — CID 8674995
N'-acetyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetohydrazide (PubChem CID 8674995) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N'-acetyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 8674995 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N'-acetyl-2-(3-ethyl-4-oxobenzo[g]quinazolin-2-yl)sulfanylacetohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(C)=O)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C18H18N4O3S/c1-3-22-17(25)14-8-12-6-4-5-7-13(12)9-15(14)19-18(22)26-10-16(24)21-20-11(2)23/h4-9H,3,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | KYSXUFFBRBPYBZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|