C17H18N2O2S — CID 110878644
3-ethyl-2-(3-hydroxypropylsulfanyl)benzo[g]quinazolin-4-one (PubChem CID 110878644) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 3-ethyl-2-(3-hydroxypropylsulfanyl)benzo[g]quinazolin-4-one.
| Compound Name | 3-ethyl-2-(3-hydroxypropylsulfanyl)benzo[g]quinazolin-4-one |
|---|---|
| PubChem CID | 110878644 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-ethyl-2-(3-hydroxypropylsulfanyl)benzo[g]quinazolin-4-one |
| SMILES | CCn1c(SCCCO)nc2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C17H18N2O2S/c1-2-19-16(21)14-10-12-6-3-4-7-13(12)11-15(14)18-17(19)22-9-5-8-20/h3-4,6-7,10-11,20H,2,5,8-9H2,1H3 |
| InChIKey | MXLZSCALDFOCOF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|