C18H24BrN3O2S — CID 42984932
2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(3-methylbutan-2-yl)acetamide (PubChem CID 42984932) has the molecular formula C18H24BrN3O2S and a molecular weight of 426.38 g/mol. Its IUPAC name is 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 42984932 |
| Molecular Formula | C18H24BrN3O2S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 2-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanyl-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CCCn1c(SCC(=O)NC(C)C(C)C)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C18H24BrN3O2S/c1-5-8-22-17(24)14-9-13(19)6-7-15(14)21-18(22)25-10-16(23)20-12(4)11(2)3/h6-7,9,11-12H,5,8,10H2,1-4H3,(H,20,23) |
| InChIKey | SWMOVBGOHNJDHA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |