C14H14BrN3OS — CID 7896375
3-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanylpropanenitrile (PubChem CID 7896375) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is 3-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanylpropanenitrile.
| Compound Name | 3-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 7896375 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 3-(6-bromo-4-oxo-3-propylquinazolin-2-yl)sulfanylpropanenitrile |
| SMILES | CCCn1c(SCCC#N)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C14H14BrN3OS/c1-2-7-18-13(19)11-9-10(15)4-5-12(11)17-14(18)20-8-3-6-16/h4-5,9H,2-3,7-8H2,1H3 |
| InChIKey | YOLLNDWSLGHOPR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|